On Target PTGES_HUMAN 0.3448276/CHEMBL584927
For the given ligand Ibuprofen, we have found in our database that, being scored 0.3448276, the most similar ligand is CHEMBL584927. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL584927 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | CC(C)(O)Cc1ccc2c(c1)c3cc(Cl)ccc3c4nc([nH]c24)c5c(cccc5C#N)C#N |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 00008002 00000000 00000100 10010200 00040061 00004000 00000000 00080000 00000900 10880840 09188004 48008800 03000004 00600000 00060040 020c000c 08400000 02002000 00a00000 00400001 40000100 28000128 21801480 00400010 00006000 80000000 00000140 00000000 00000004 00420c02 40000800 00020480 |