On Target PTGES_HUMAN 0.43307087/CHEMBL4084995
For the given ligand Tramadol, we have found in our database that, being scored 0.43307087, the most similar ligand is CHEMBL4084995. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL4084995 (Similar Ligand) |
|---|---|
| COc2cccc([C@@]1(O)CCCC[C@@H]1CN(C)C)c2 | OC(=O)c1ccccc1CC[C@@H]2CCC[C@@H]2NC(=O)C3CCN(CC3)c4ccc(OC(F)(F)F)cc4 |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 00024002 01001808 2010010a 00010600 20001010 0000e000 02000000 20000008 00300900 000808c0 08300004 50439800 04008022 00200000 01020061 00080008 00040000 02000000 08002000 00020201 40500500 18060e70 20004008 0050001c 00000000 80000201 00040000 d0000080 02008202 01060003 c0020000 00802600 |