On Target MIF_HUMAN 0.21276596/CHEMBL3797437
For the given ligand Amitriptyline, we have found in our database that, being scored 0.21276596, the most similar ligand is CHEMBL3797437. Check out the elaboration below.
| Amitriptyline (Given Ligand) | CHEMBL3797437 (Similar Ligand) |
|---|---|
| CN(C)CC/C=C/2c1ccccc1CCc3ccccc23 | Oc1cc2OCOc2cc1C(N3CCOCC3)c4ccc(cc4)C(F)(F)F |
|
|
|
|
|
|
| 00080000 08000000 00100300 00010600 22000000 00002002 80080480 01000401 04000800 00180840 08300000 40008000 00000000 00200000 00000002 00000002 00000400 02000040 00100000 00000001 00100100 18100000 0040c000 00400810 01000000 a0000001 00402000 40000000 02400080 00060c02 04000000 00000700 | 00000009 46000008 20100108 80010600 00001080 00000000 42040400 03001600 00200100 00180850 48200000 40008800 80004802 21000000 01001409 0028a108 10000000 02000000 00080000 00020a00 00040200 08008000 12000000 00468010 40000400 e0000000 003a0100 f0000001 01040380 00060002 06140000 02010600 |