On Target IKKB_HUMAN 0.45454547/CHEMBL3318321
For the given ligand Tramadol, we have found in our database that, being scored 0.45454547, the most similar ligand is CHEMBL3318321. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL3318321 (Similar Ligand) |
|---|---|
| COc2cccc([C@@]1(O)CCCC[C@@H]1CN(C)C)c2 | O[C@H]1CCC(=O)c2c(O)cccc12 |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 00050000 4b000808 20000102 00010200 00080000 4002c000 02000000 00000201 00000900 00080840 08100000 40009840 04008002 00200000 00000000 00082008 00000200 02000000 00402000 00020201 00400500 08020360 01004000 00400014 00000000 80000201 00000000 00000000 00000002 00024002 c0000000 00400400 |