On Target IKKB_HUMAN 0.3263889/CHEMBL602534
For the given ligand Amitriptyline, we have found in our database that, being scored 0.3263889, the most similar ligand is CHEMBL602534. Check out the elaboration below.
| Amitriptyline (Given Ligand) | CHEMBL602534 (Similar Ligand) |
|---|---|
| CN(C)CC/C=C/2c1ccccc1CCc3ccccc23 | NC(=O)NC1=C(C=C(C1)c2ccc(F)cc2)C(=O)N |
|
|
|
|
|
|
| 00080000 08000000 00100300 00010600 22000000 00002002 80080480 01000401 04000800 00180840 08300000 40008000 00000000 00200000 00000002 00000002 00000400 02000040 00100000 00000001 00100100 18100000 0040c000 00400810 01000000 a0000001 00402000 40000000 02400080 00060c02 04000000 00000700 | 00400010 08041200 00900300 02190e00 00000000 00000011 800800c0 00142406 01000c40 001808c2 08300080 41009400 00129000 00001000 00080202 00040100 20080400 020001c0 50030084 01100101 00008511 18050680 00048000 00404818 01000000 80000100 00402000 d0040501 00400000 08068c0b 04080000 81010600 |