On Target MK03_HUMAN 0.1904762/CHEMBL3798926
For the given ligand Amitriptyline, we have found in our database that, being scored 0.1904762, the most similar ligand is CHEMBL3798926. Check out the elaboration below.
| Amitriptyline (Given Ligand) | CHEMBL3798926 (Similar Ligand) |
|---|---|
| CN(C)CC/C=C/2c1ccccc1CCc3ccccc23 | O=C(NCCCc1ccccc1)c2ccc3[nH]nc(c4ccncc4)c3c2 |
|
|
|
|
|
|
| 00080000 08000000 00100300 00010600 22000000 00002002 80080480 01000401 04000800 00180840 08300000 40008000 00000000 00200000 00000002 00000002 00000400 02000040 00100000 00000001 00100100 18100000 0040c000 00400810 01000000 a0000001 00402000 40000000 02400080 00060c02 04000000 00000700 | 00002002 00009a08 a0104100 40010600 01040000 00000002 02400000 22001000 00000900 000808c0 08300004 60008000 80008812 00400000 00000400 000c200c 00220000 02000004 04600000 10220201 40000100 1c068608 30800800 0060401c 00100000 c0000000 10020000 90000060 00004104 0006000b a0040400 00004620 |