On Target NMDZ1_HUMAN 0.33516484/CHEMBL354003
For the given ligand Lisinopril, we have found in our database that, being scored 0.33516484, the most similar ligand is CHEMBL354003. Check out the elaboration below.
| Lisinopril (Given Ligand) | CHEMBL354003 (Similar Ligand) |
|---|---|
| NCCCC[C@H](N[C@@H](CCc1ccccc1)C(=O)O)C(=O)N2CCC[C@H]2C(=O)O | OC(=O)c1[nH]c2cc(Cl)cc(Cl)c2c1CN3CC(=O)N(C4CCCCC4)C3=O |
|
|
|
|
|
|
| 00010000 01005200 00100102 04010600 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01202003 80180000 000c0008 10000000 02000000 00402000 00000201 00000100 38040e30 03000001 02500018 00000000 80000000 00000000 10000000 08000000 0006000b 20004000 00402600 | 10018002 09803800 00100100 14010e10 000c1020 0000c020 04004084 2a003008 00000300 000908c8 01280004 4001a800 0600988e 0070a400 800204c0 020c000c 0006c008 0280200c 02202040 00000201 c0020100 38078ff8 20802003 8250011c 00056000 c0000400 08044000 90000000 08000104 00060001 e00cc200 80420220 |