Created at: Last updated at: Current status:
|
Name | Captopril |
2D and 3D depictions | |
SMILES | C[C@H](CS)C(=O)N1CCC[C@H]1C(=O)O |
Model downloads | |
Fingerprints |
Name | Fosinopril |
2D and 3D depictions | |
SMILES | CCC(=O)O[C@@H](OP(=O)(CCCCc1ccccc1)CC(=O)N3C[C@H](C2CCCCC2)C[C@H]3C(=O)O)C(C)C |
Model downloads | |
Fingerprints |
Name | Lisinopril |
2D and 3D depictions | |
SMILES | NCCCC[C@H](N[C@@H](CCc1ccccc1)C(=O)O)C(=O)N2CCC[C@H]2C(=O)O |
Model downloads | |
Fingerprints |
Name | Ramipril |
2D and 3D depictions | |
SMILES | CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3[C@H](C(=O)O)C[C@@H]2CCC[C@@H]23 |
Model downloads | |
Fingerprints |
Name | Moexipril |
2D and 3D depictions | |
SMILES | CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3Cc2cc(OC)c(OC)cc2C[C@H]3C(=O)O |
Model downloads | |
Fingerprints |