On Target PERM_HUMAN 0.26288658/CHEMBL2347029
For the given ligand Fosinopril, we have found in our database that, being scored 0.26288658, the most similar ligand is CHEMBL2347029. Check out the elaboration below.
| Fosinopril (Given Ligand) | CHEMBL2347029 (Similar Ligand) |
|---|---|
| CCC(=O)O[C@@H](OP(=O)(CCCCc1ccccc1)CC(=O)N3C[C@H](C2CCCCC2)C[C@H]3C(=O)O)C(C)C | CCNC(=O)CCCc1c[nH]c2ccc(F)cc12 |
|
|
|
|
|
|
| 00010440 03005208 0010050a 00050e20 00080081 00000010 00004900 30000000 0000c800 000808e0 09300001 4011b000 0600801a 01a200b0 82095000 20281608 100a0028 02100003 c2406010 00000201 01004120 19562e10 03c00000 80508218 00002402 80000100 22000400 38214000 008c0200 01060303 30864000 0000c621 | 00010002 01000800 00100102 42810610 00041100 00000030 00002000 20000000 00500800 000808c0 08300004 40019000 0c008802 00601800 00000040 00040005 00000000 02000080 00200400 00100201 40000100 18008608 20800000 80500018 00042000 80000000 08000000 10000001 00000000 00078003 00040200 00400620 |