On Target PERM_HUMAN 0.23076923/CHEMBL2347029
For the given ligand Captopril, we have found in our database that, being scored 0.23076923, the most similar ligand is CHEMBL2347029. Check out the elaboration below.
| Captopril (Given Ligand) | CHEMBL2347029 (Similar Ligand) |
|---|---|
| C[C@H](CS)C(=O)N1CCC[C@H]1C(=O)O | CCNC(=O)CCCc1c[nH]c2ccc(F)cc12 |
|
|
|
|
|
|
| 00010000 01005000 00100000 00100400 00080080 00000010 00000000 20000000 00000000 00000080 00200000 40013000 06008012 01040000 80080000 00080008 10000000 00000000 00400000 00400201 40000000 10040e00 03000200 00100018 00000000 00000000 00000000 10000000 00000000 00040021 20004000 01012200 | 00010002 01000800 00100102 42810610 00041100 00000030 00002000 20000000 00500800 000808c0 08300004 40019000 0c008802 00601800 00000040 00040005 00000000 02000080 00200400 00100201 40000100 18008608 20800000 80500018 00042000 80000000 08000000 10000001 00000000 00078003 00040200 00400620 |