On Target PERM_HUMAN 0.3809524/CHEMBL2347029
For the given ligand Lisinopril, we have found in our database that, being scored 0.3809524, the most similar ligand is CHEMBL2347029. Check out the elaboration below.
| Lisinopril (Given Ligand) | CHEMBL2347029 (Similar Ligand) |
|---|---|
| NCCCC[C@H](N[C@@H](CCc1ccccc1)C(=O)O)C(=O)N2CCC[C@H]2C(=O)O | CCNC(=O)CCCc1c[nH]c2ccc(F)cc12 |
|
|
|
|
|
|
| 00010000 01005200 00100102 04010600 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01202003 80180000 000c0008 10000000 02000000 00402000 00000201 00000100 38040e30 03000001 02500018 00000000 80000000 00000000 10000000 08000000 0006000b 20004000 00402600 | 00010002 01000800 00100102 42810610 00041100 00000030 00002000 20000000 00500800 000808c0 08300004 40019000 0c008802 00601800 00000040 00040005 00000000 02000080 00200400 00100201 40000100 18008608 20800000 80500018 00042000 80000000 08000000 10000001 00000000 00078003 00040200 00400620 |