On Target ACES_HUMAN 0.3548387/CHEMBL1080631
For the given ligand Fosinopril, we have found in our database that, being scored 0.3548387, the most similar ligand is CHEMBL1080631. Check out the elaboration below.
| Fosinopril (Given Ligand) | CHEMBL1080631 (Similar Ligand) |
|---|---|
| CCC(=O)O[C@@H](OP(=O)(CCCCc1ccccc1)CC(=O)N3C[C@H](C2CCCCC2)C[C@H]3C(=O)O)C(C)C | CCCCCCOC(=O)[C@H](CCC(=O)NCCC1CCN(Cc2ccccc2)CC1)NC(=O)c3ccccc3 |
|
|
|
|
|
|
| 00010440 03005208 0010050a 00050e20 00080081 00000010 00004900 30000000 0000c800 000808e0 09300001 4011b000 0600801a 01a200b0 82095000 20281608 100a0028 02100003 c2406010 00000201 01004120 19562e10 03c00000 80508218 00002402 80000100 22000400 38214000 008c0200 01060303 30864000 0000c621 | 00038048 01005800 00100100 80010700 00080080 00000000 00000000 22001000 00200000 000208c0 00200000 5003b000 06008832 01800000 00001408 00081008 10820000 02000000 00402000 00000201 00000020 18068e20 13000000 0050001c 10000400 c0000000 00800000 90000001 00000300 00060003 a0044000 00802200 |