On Target ACES_HUMAN 0.5460123/CHEMBL3262665
For the given ligand Moexipril, we have found in our database that, being scored 0.5460123, the most similar ligand is CHEMBL3262665. Check out the elaboration below.
| Moexipril (Given Ligand) | CHEMBL3262665 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3Cc2cc(OC)c(OC)cc2C[C@H]3C(=O)O | COc1cc2CCNC(Cc3ccc(OCCCCCCN4CCCCC4C)cc3)c2cc1OC |
|
|
|
|
|
|
| 00018008 47805208 2010010a 94010700 000810a0 c0000000 03041000 22001004 00000880 000908c0 08302000 4000b000 0600c882 20202003 81181489 000c9008 10820200 02000020 00480008 00020201 80020120 38208e00 13004041 83448018 00000c00 c0000001 00324000 90000001 0c000300 0086000b 20044000 00402600 | 04000008 47000008 20100108 10010700 00081020 c2000002 02040000 22001001 00000880 000808c0 08300000 50818000 00804802 20a00000 11000401 0008a008 00800000 02000020 00482000 00020201 00020100 18308010 01404000 81548010 00000000 c0000001 00320000 90000000 04000300 0006000a 20040000 00002700 |