On Target PDE5A_HUMAN 0.29126215/CHEMBL190423
For the given ligand Fosinopril, we have found in our database that, being scored 0.29126215, the most similar ligand is CHEMBL190423. Check out the elaboration below.
| Fosinopril (Given Ligand) | CHEMBL190423 (Similar Ligand) |
|---|---|
| CCC(=O)O[C@@H](OP(=O)(CCCCc1ccccc1)CC(=O)N3C[C@H](C2CCCCC2)C[C@H]3C(=O)O)C(C)C | CCc1cc(C(=O)C)c(O)cc1OCc2cccc(c2)C(=O)NCCCCCCCCC(=O)O |
|
|
|
|
|
|
| 00010440 03005208 0010050a 00050e20 00080081 00000010 00004900 30000000 0000c800 000808e0 09300001 4011b000 0600801a 01a200b0 82095000 20281608 100a0028 02100003 c2406010 00000201 01004120 19562e10 03c00000 80508218 00002402 80000100 22000400 38214000 008c0200 01060303 30864000 0000c621 | 04010001 01001808 20100109 00010600 00081001 80024000 52040000 22001200 00000100 00080ac0 48200000 40019000 0480880a 00810000 01000401 0a082008 00000000 02008000 00402000 40020a01 00000000 18068e30 01000000 00d0101c 00004000 c0002000 08120000 90800000 00010300 00060003 e0060004 00000600 |