On Target PDE5A_HUMAN 0.5675676/CHEMBL30936
For the given ligand Moexipril, we have found in our database that, being scored 0.5675676, the most similar ligand is CHEMBL30936. Check out the elaboration below.
| Moexipril (Given Ligand) | CHEMBL30936 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3Cc2cc(OC)c(OC)cc2C[C@H]3C(=O)O | O=C1CN(CCN2CCOCC2)C(=O)[C@H]3Cc4c([nH]c5ccccc45)[C@H](N13)c6ccc7OCOc7c6 |
|
|
|
|
|
|
| 00018008 47805208 2010010a 94010700 000810a0 c0000000 03041000 22001004 00000880 000908c0 08302000 4000b000 0600c882 20202003 81181489 000c9008 10820200 02000020 00480008 00020201 80020120 38208e00 13004041 83448018 00000c00 c0000001 00324000 90000001 0c000300 0086000b 20044000 00402600 | 0001800a 4680fa08 20100108 d5810e10 000412a0 00180002 03042400 2300300d 00600880 000908c0 48318004 4080b000 1e00c882 2060a801 811214c9 022c818c 10000200 02000027 00380408 00020a01 c0060300 38238608 32804023 93468018 40143c00 e0000001 08324000 f0000001 0f000384 0086000b 20044200 20014620 |