On Target PDE5A_HUMAN 0.37323943/CHEMBL190423
For the given ligand Lisinopril, we have found in our database that, being scored 0.37323943, the most similar ligand is CHEMBL190423. Check out the elaboration below.
| Lisinopril (Given Ligand) | CHEMBL190423 (Similar Ligand) |
|---|---|
| NCCCC[C@H](N[C@@H](CCc1ccccc1)C(=O)O)C(=O)N2CCC[C@H]2C(=O)O | CCc1cc(C(=O)C)c(O)cc1OCc2cccc(c2)C(=O)NCCCCCCCCC(=O)O |
|
|
|
|
|
|
| 00010000 01005200 00100102 04010600 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01202003 80180000 000c0008 10000000 02000000 00402000 00000201 00000100 38040e30 03000001 02500018 00000000 80000000 00000000 10000000 08000000 0006000b 20004000 00402600 | 04010001 01001808 20100109 00010600 00081001 80024000 52040000 22001200 00000100 00080ac0 48200000 40019000 0480880a 00810000 01000401 0a082008 00000000 02008000 00402000 40020a01 00000000 18068e30 01000000 00d0101c 00004000 c0002000 08120000 90800000 00010300 00060003 e0060004 00000600 |