On Target COMT_HUMAN 0.2320819/CHEMBL3819488
For the given ligand Fosinopril, we have found in our database that, being scored 0.2320819, the most similar ligand is CHEMBL3819488. Check out the elaboration below.
| Fosinopril (Given Ligand) | CHEMBL3819488 (Similar Ligand) |
|---|---|
| CCC(=O)O[C@@H](OP(=O)(CCCCc1ccccc1)CC(=O)N3C[C@H](C2CCCCC2)C[C@H]3C(=O)O)C(C)C | CN(Cc1ccc(cc1)C(=O)c2cc(O)c(O)c(c2)[N+](=O)[O-])C(=O)CCCCCNC(=O)C[C@H](NC(=O)c3ccc(cc3)N=[N+]=[N-])C(=O)NCCCOCCOCCOCCCNC(=O)CCCC[C@@H]4SC[C@@H]5NC(=O)N[C@H]45 |
|
|
|
|
|
|
| 00010440 03005208 0010050a 00050e20 00080081 00000010 00004900 30000000 0000c800 000808e0 09300001 4011b000 0600801a 01a200b0 82095000 20281608 100a0028 02100003 c2406010 00000201 01004120 19562e10 03c00000 80508218 00002402 80000100 22000400 38214000 008c0200 01060303 30864000 0000c621 | 08038002 c7803c18 20101101 c4110e40 00004000 00000000 02002004 23003048 14602300 020949e0 0c200004 4007b800 8e019a0e 000c2100 20100541 300ac018 04209000 02802001 00802070 00020701 c4020120 381f8610 25000393 0a72141c 00851403 e0000000 80124000 d000a020 88500382 00060033 a00e4000 27812600 |