On Target TRPV1_RAT 0.3368984/CHEMBL101775
For the given ligand Fosinopril, we have found in our database that, being scored 0.3368984, the most similar ligand is CHEMBL101775. Check out the elaboration below.
| Fosinopril (Given Ligand) | CHEMBL101775 (Similar Ligand) |
|---|---|
| CCC(=O)O[C@@H](OP(=O)(CCCCc1ccccc1)CC(=O)N3C[C@H](C2CCCCC2)C[C@H]3C(=O)O)C(C)C | COc1cc(CC(=O)NCC(CCc2ccccc2)COC(=O)C(C)(C)C)ccc1O |
|
|
|
|
|
|
| 00010440 03005208 0010050a 00050e20 00080081 00000010 00004900 30000000 0000c800 000808e0 09300001 4011b000 0600801a 01a200b0 82095000 20281608 100a0028 02100003 c2406010 00000201 01004120 19562e10 03c00000 80508218 00002402 80000100 22000400 38214000 008c0200 01060303 30864000 0000c621 | 00000040 43001008 2010010a 00010700 00081000 80000000 02000000 20000000 00100880 000808c0 08300000 40019000 0100c002 20280000 41000001 00089008 00a20000 02000000 00c80000 00020201 00000120 18340e00 01000080 81500018 00000401 80000000 00120000 10010000 04000200 00060007 00002000 00002600 |