On Target TRPV1_RAT 0.48850575/CHEMBL239389
For the given ligand Moexipril, we have found in our database that, being scored 0.48850575, the most similar ligand is CHEMBL239389. Check out the elaboration below.
| Moexipril (Given Ligand) | CHEMBL239389 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3Cc2cc(OC)c(OC)cc2C[C@H]3C(=O)O | COc1cc(CNC(=S)NC(CCc2ccc(cc2)C(C)(C)C)COC(=O)C(C)(C)C)ccc1O |
|
|
|
|
|
|
| 00018008 47805208 2010010a 94010700 000810a0 c0000000 03041000 22001004 00000880 000908c0 08302000 4000b000 0600c882 20202003 81181489 000c9008 10820200 02000020 00480008 00020201 80020120 38208e00 13004041 83448018 00000c00 c0000001 00324000 90000001 0c000300 0086000b 20044000 00402600 | 00000050 45000208 2010030a 80210f00 00081080 00000000 02000004 22003000 00001d00 000808c0 09300000 40009800 0000d802 00200000 01001009 000c9008 20874000 02000000 00480040 00020201 00000120 18218a00 13000000 00448010 10010400 80000000 00220000 b0000000 01200300 0006000a 000c0000 80010608 |