On Target TRPV1_RAT 0.45652175/CHEMBL254663
For the given ligand Ramipril, we have found in our database that, being scored 0.45652175, the most similar ligand is CHEMBL254663. Check out the elaboration below.
| Ramipril (Given Ligand) | CHEMBL254663 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3[C@H](C(=O)O)C[C@@H]2CCC[C@@H]23 | Cc1ccc(CC(CNC(=O)C2(CC2)c3ccc(NS(=O)(=O)C)cc3)COC(=O)C(C)(C)C)cc1C |
|
|
|
|
|
|
| 00010000 01005200 00100102 84010700 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01a02003 80181008 000c1008 10820000 02000000 00402000 00000201 00000120 38040e10 13000001 02500018 00000400 80000000 00000000 10000001 08000200 0106000b 20024000 00402600 | 00000042 00001a08 00100102 40310700 00000001 00000000 00000000 20000000 00000980 000808c0 08302004 40009800 05008402 01280001 c0080040 000e1008 00220000 02000000 00c00000 00004201 40000120 18340e00 210000c0 81400018 00000481 80000000 00000000 1000000c 04000200 0006000f 00002000 00012660 |