On Target TRPV1_RAT 0.49532712/CHEMBL237138
For the given ligand Lisinopril, we have found in our database that, being scored 0.49532712, the most similar ligand is CHEMBL237138. Check out the elaboration below.
| Lisinopril (Given Ligand) | CHEMBL237138 (Similar Ligand) |
|---|---|
| NCCCC[C@H](N[C@@H](CCc1ccccc1)C(=O)O)C(=O)N2CCC[C@H]2C(=O)O | NCCCCCCN(CCc1ccc(Cl)cc1Cl)CC(=O)N(CCc2ccc(Cl)cc2Cl)CC(=O)N |
|
|
|
|
|
|
| 00010000 01005200 00100102 04010600 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01202003 80180000 000c0008 10000000 02000000 00402000 00000201 00000100 38040e30 03000001 02500018 00000000 80000000 00000000 10000000 08000000 0006000b 20004000 00402600 | 00008000 01003000 00110100 04010600 00000000 00000020 00000000 20000004 00000080 000808c0 08200000 4001a900 02008026 00002401 80000000 00000000 00000000 02000000 00002000 00000201 00000400 38200710 00000003 83500018 00002000 80000200 00040000 10000000 0c000000 00060003 20004000 00022600 |