On Target FABP5_HUMAN 0.2542373/CHEMBL82293
For the given ligand Captopril, we have found in our database that, being scored 0.2542373, the most similar ligand is CHEMBL82293. Check out the elaboration below.
| Captopril (Given Ligand) | CHEMBL82293 (Similar Ligand) |
|---|---|
| C[C@H](CS)C(=O)N1CCC[C@H]1C(=O)O | CCCCCCCCCCCCCCCC(=O)O |
|
|
|
|
|
|
| 00010000 01005000 00100000 00100400 00080080 00000010 00000000 20000000 00000000 00000080 00200000 40013000 06008012 01040000 80080000 00080008 10000000 00000000 00400000 00400201 40000000 10040e00 03000200 00100018 00000000 00000000 00000000 10000000 00000000 00040021 20004000 01012200 | 00010000 01000000 00000000 00000000 00080000 00000000 00000000 00000000 00000000 00000000 00000000 40001000 04008008 00800000 00000000 00080008 00000000 00000000 00402000 00000001 00000000 00000a00 01000000 00000010 00000000 00000000 00000000 00000000 00000000 00000000 00020000 00000000 |