On Target FABP5_HUMAN 0.28/CHEMBL247920
For the given ligand Moexipril, we have found in our database that, being scored 0.28, the most similar ligand is CHEMBL247920. Check out the elaboration below.
| Moexipril (Given Ligand) | CHEMBL247920 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3Cc2cc(OC)c(OC)cc2C[C@H]3C(=O)O | CCc1c(c2ccccc2)c(nn1c3ccccc3c4cccc(OCC(=O)O)c4)c5ccccc5 |
|
|
|
|
|
|
| 00018008 47805208 2010010a 94010700 000810a0 c0000000 03041000 22001004 00000880 000908c0 08302000 4000b000 0600c882 20202003 81181489 000c9008 10820200 02000020 00480008 00020201 80020120 38208e00 13004041 83448018 00000c00 c0000001 00324000 90000001 0c000300 0086000b 20044000 00402600 | 0400a006 40000209 a0000188 10010610 21081020 0010600a 02440000 00081200 00000104 100d88c0 01048084 6000c800 02808812 00300280 21220841 820c204c 00020240 82c03000 04480100 00621240 40020040 1841aa24 34806800 8b404518 00802001 c10800c0 14120008 00800861 04004384 1046040b 40861a00 800004a2 |