On Target FABP5_HUMAN 0.22994652/CHEMBL3941588
For the given ligand Ramipril, we have found in our database that, being scored 0.22994652, the most similar ligand is CHEMBL3941588. Check out the elaboration below.
| Ramipril (Given Ligand) | CHEMBL3941588 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3[C@H](C(=O)O)C[C@@H]2CCC[C@@H]23 | OC(=O)c1c(nc2ccc(Cl)cc2c1c3ccccc3)N4CCCCC4 |
|
|
|
|
|
|
| 00010000 01005200 00100102 84010700 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01a02003 80181008 000c1008 10820000 02000000 00402000 00000201 00000120 38040e10 13000001 02500018 00000400 80000000 00000000 10000001 08000200 0106000b 20024000 00402600 | 1801e002 01800801 40104100 00010610 20041004 0001e040 04000000 00100000 00c00100 200008d0 00200004 70019800 8700880e 00600000 20020040 000c000e 00060000 02004004 0c200000 00a00201 c0100000 1c068b68 30800800 8070001c 00042000 80080000 08040280 100010c0 0040c008 00060800 c0041000 01020220 |