On Target PAR1_HUMAN 0.32524273/CHEMBL80942
For the given ligand Fosinopril, we have found in our database that, being scored 0.32524273, the most similar ligand is CHEMBL80942. Check out the elaboration below.
| Fosinopril (Given Ligand) | CHEMBL80942 (Similar Ligand) |
|---|---|
| CCC(=O)O[C@@H](OP(=O)(CCCCc1ccccc1)CC(=O)N3C[C@H](C2CCCCC2)C[C@H]3C(=O)O)C(C)C | OC(=O)C[C@H](NC(=O)[C@@H]1CCCN(C1)C(=O)CCC2CCNCC2)c3ccc4OCOc4c3 |
|
|
|
|
|
|
| 00010440 03005208 0010050a 00050e20 00080081 00000010 00004900 30000000 0000c800 000808e0 09300001 4011b000 0600801a 01a200b0 82095000 20281608 100a0028 02100003 c2406010 00000201 01004120 19562e10 03c00000 80508218 00002402 80000100 22000400 38214000 008c0200 01060303 30864000 0000c621 | 00010000 47801408 20100108 00010600 00001000 40000000 02040000 22001000 00200800 000809e0 48300000 50019000 0c00c81a 20000000 01000401 00288008 00000000 02000001 00c82018 00020201 80040300 181c8e30 010000c0 00548018 40001801 c0000000 00320000 b0000000 01000300 00060013 20040000 00012600 |