On Target SC6A4_HUMAN 0.38043478/CHEMBL3940791
For the given ligand Captopril, we have found in our database that, being scored 0.38043478, the most similar ligand is CHEMBL3940791. Check out the elaboration below.
| Captopril (Given Ligand) | CHEMBL3940791 (Similar Ligand) |
|---|---|
| C[C@H](CS)C(=O)N1CCC[C@H]1C(=O)O | CCC(NC(CC(C)C)C1(CCC1)c2ccc(Cl)cc2)C(=O)O |
|
|
|
|
|
|
| 00010000 01005000 00100000 00100400 00080080 00000010 00000000 20000000 00000000 00000080 00200000 40013000 06008012 01040000 80080000 00080008 10000000 00000000 00400000 00400201 40000000 10040e00 03000200 00100018 00000000 00000000 00000000 10000000 00000000 00040021 20004000 01012200 | 00008000 01000000 00100102 00010600 00000080 00000000 00000000 20000000 00000880 000808c0 08300000 4001b800 06008026 00200010 80080000 00080008 10000000 02000000 00402000 00000201 00000100 18200b00 03000000 81500010 00002000 80000000 00040000 10000000 04000002 00060002 00024000 00022600 |