On Target SC6A4_HUMAN 0.5862069/CHEMBL315172
For the given ligand Ramipril, we have found in our database that, being scored 0.5862069, the most similar ligand is CHEMBL315172. Check out the elaboration below.
| Ramipril (Given Ligand) | CHEMBL315172 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3[C@H](C(=O)O)C[C@@H]2CCC[C@@H]23 | COC(=O)C1C2C[C@H](O)C(CC1c3ccc4ccccc4c3)N2C |
|
|
|
|
|
|
| 00010000 01005200 00100102 84010700 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01a02003 80181008 000c1008 10820000 02000000 00402000 00000201 00000120 38040e10 13000001 02500018 00000400 80000000 00000000 10000001 08000200 0106000b 20024000 00402600 | 00010000 01000208 00100102 00010700 00080080 00000010 00000000 20000000 00000800 000808c0 08300000 50019000 0c00803a 03a00000 00080000 000c0008 10a20000 02000000 00c02018 00000201 00000100 18000a18 030000c0 00500010 00001801 80000000 00000000 10001000 00000202 0006000a 00020000 00002600 |