On Target HYES_HUMAN 0.62857145/CHEMBL376597
For the given ligand Captopril, we have found in our database that, being scored 0.62857145, the most similar ligand is CHEMBL376597. Check out the elaboration below.
| Captopril (Given Ligand) | CHEMBL376597 (Similar Ligand) |
|---|---|
| C[C@H](CS)C(=O)N1CCC[C@H]1C(=O)O | CCCCCCCCC(NC(=O)CCCCCCCCCCCNC(=O)NC12CC3CC(CC(C3)C1)C2)C(=O)O |
|
|
|
|
|
|
| 00010000 01005000 00100000 00100400 00080080 00000010 00000000 20000000 00000000 00000080 00200000 40013000 06008012 01040000 80080000 00080008 10000000 00000000 00400000 00400201 40000000 10040e00 03000200 00100018 00000000 00000000 00000000 10000000 00000000 00040021 20004000 01012200 | 00010000 01005000 00100000 00000c00 00080080 00000000 00000004 20002000 00000000 00000080 00200000 40013000 0600900a 00800000 80080000 00080008 10000000 00000000 02402040 00000201 00000100 10050e10 03000000 00100018 00010000 00000000 00000000 10000000 00000000 00040001 200a4000 00002200 |