On Target HYES_HUMAN 0.5153374/CHEMBL219132
For the given ligand Moexipril, we have found in our database that, being scored 0.5153374, the most similar ligand is CHEMBL219132. Check out the elaboration below.
| Moexipril (Given Ligand) | CHEMBL219132 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3Cc2cc(OC)c(OC)cc2C[C@H]3C(=O)O | OC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](Cc2ccccc2)NC(=O)CCCCCNC(=O)NC3CCCCC3 |
|
|
|
|
|
|
| 00018008 47805208 2010010a 94010700 000810a0 c0000000 03041000 22001004 00000880 000908c0 08302000 4000b000 0600c882 20202003 81181489 000c9008 10820200 02000020 00480008 00020201 80020120 38208e00 13004041 83448018 00000c00 c0000001 00324000 90000001 0c000300 0086000b 20044000 00402600 | 00010000 01007208 20100100 04010e00 00000080 00000000 02000004 2000200c 00000880 000808c0 08300000 4001b000 0600900a 00002001 80180000 000c0008 10000000 02000000 02402048 00020201 00000100 38250e10 03000041 83500018 00010800 80000000 00120000 10000000 0c000000 0006000b 20084000 00002600 |