On Target HYES_HUMAN 0.6694915/CHEMBL216164
For the given ligand Ramipril, we have found in our database that, being scored 0.6694915, the most similar ligand is CHEMBL216164. Check out the elaboration below.
| Ramipril (Given Ligand) | CHEMBL216164 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3[C@H](C(=O)O)C[C@@H]2CCC[C@@H]23 | OC(=O)[C@@H]1CCCN1C(=O)[C@H](Cc2ccccc2)NC(=O)CCCCCNC(=O)NC3CCCCC3 |
|
|
|
|
|
|
| 00010000 01005200 00100102 84010700 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01a02003 80181008 000c1008 10820000 02000000 00402000 00000201 00000120 38040e10 13000001 02500018 00000400 80000000 00000000 10000001 08000200 0106000b 20024000 00402600 | 00010000 01007200 00100100 04010e00 00080080 00000010 00000004 2000200c 00000880 000808c0 08300000 4001b000 0600901a 01002001 80180000 000c0008 10000000 02000000 02402048 00000201 00000100 38250e10 03000001 83500018 00010800 80000000 00000000 10000000 0c000000 0006000b 20084000 00002600 |