On Target AMPN_HUMAN 0.45901638/CHEMBL3804856
For the given ligand Fosinopril, we have found in our database that, being scored 0.45901638, the most similar ligand is CHEMBL3804856. Check out the elaboration below.
| Fosinopril (Given Ligand) | CHEMBL3804856 (Similar Ligand) |
|---|---|
| CCC(=O)O[C@@H](OP(=O)(CCCCc1ccccc1)CC(=O)N3C[C@H](C2CCCCC2)C[C@H]3C(=O)O)C(C)C | NC(CNC1CCCCC1)P(=O)(O)CC(Cc2ccccc2)C(=O)O |
|
|
|
|
|
|
| 00010440 03005208 0010050a 00050e20 00080081 00000010 00004900 30000000 0000c800 000808e0 09300001 4011b000 0600801a 01a200b0 82095000 20281608 100a0028 02100003 c2406010 00000201 01004120 19562e10 03c00000 80508218 00002402 80000100 22000400 38214000 008c0200 01060303 30864000 0000c621 | 00000400 03000600 0010010c 00010620 00000000 40000000 00a00000 20000000 00000800 000808c0 89300081 40119000 04008002 000a0000 0a000000 00081008 00000028 02500000 c2402008 00008201 00000100 39301a10 01c01841 82500010 00002802 80000000 00000002 10014000 080c0600 00060302 30800000 0080ce23 |