On Target AOFA_HUMAN 0.2606635/CHEMBL4073457
For the given ligand Fosinopril, we have found in our database that, being scored 0.2606635, the most similar ligand is CHEMBL4073457. Check out the elaboration below.
| Fosinopril (Given Ligand) | CHEMBL4073457 (Similar Ligand) |
|---|---|
| CCC(=O)O[C@@H](OP(=O)(CCCCc1ccccc1)CC(=O)N3C[C@H](C2CCCCC2)C[C@H]3C(=O)O)C(C)C | O=C1CCc2ccc(OCCCCCCN3CCC(Cc4ccccc4)CC3)cc2N1 |
|
|
|
|
|
|
| 00010440 03005208 0010050a 00050e20 00080081 00000010 00004900 30000000 0000c800 000808e0 09300001 4011b000 0600801a 01a200b0 82095000 20281608 100a0028 02100003 c2406010 00000201 01004120 19562e10 03c00000 80508218 00002402 80000100 22000400 38214000 008c0200 01060303 30864000 0000c621 | 04004002 81000208 2010010a 00010700 30081000 06002040 02040000 20000000 00100800 000808c0 08380024 50019000 04808002 08b00000 11020041 000c2008 00848080 02000000 08402008 00022601 40100100 18000610 21002000 00500010 00000800 81000000 00120010 10001080 00008200 0006000b 00000000 20022600 |