On Target AOFA_HUMAN 0.43333334/CHEMBL3330339
For the given ligand Lisinopril, we have found in our database that, being scored 0.43333334, the most similar ligand is CHEMBL3330339. Check out the elaboration below.
| Lisinopril (Given Ligand) | CHEMBL3330339 (Similar Ligand) |
|---|---|
| NCCCC[C@H](N[C@@H](CCc1ccccc1)C(=O)O)C(=O)N2CCC[C@H]2C(=O)O | C[C@]1(N)C[C@@H]1c2ccccc2.OC(=O)C(F)(F)F |
|
|
|
|
|
|
| 00010000 01005200 00100102 04010600 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01202003 80180000 000c0008 10000000 02000000 00402000 00000201 00000100 38040e30 03000001 02500018 00000000 80000000 00000000 10000000 08000000 0006000b 20004000 00402600 | 00000000 01000200 00100102 00010600 00000000 00000000 00000000 00000000 00000800 000808c0 08100000 40008000 00008000 01200000 00000000 00080008 00000000 02000000 00000000 00000005 00000100 18000a00 00000000 81400010 00000000 80000000 00000000 90000000 04000000 0006000a 00000000 00000600 |