On Target ADRB2_HUMAN 0.34615386/CHEMBL1085010
For the given ligand Captopril, we have found in our database that, being scored 0.34615386, the most similar ligand is CHEMBL1085010. Check out the elaboration below.
| Captopril (Given Ligand) | CHEMBL1085010 (Similar Ligand) |
|---|---|
| C[C@H](CS)C(=O)N1CCC[C@H]1C(=O)O | CC(C)c1ccccc1OCC(O)CN2CCC(CN3C(=O)CCCC3=O)CC2 |
|
|
|
|
|
|
| 00010000 01005000 00100000 00100400 00080080 00000010 00000000 20000000 00000000 00000080 00200000 40013000 06008012 01040000 80080000 00080008 10000000 00000000 00400000 00400201 40000000 10040e00 03000200 00100018 00000000 00000000 00000000 10000000 00000000 00040021 20004000 01012200 | 04010000 01001008 20100108 00010600 00001080 82000000 02000000 20000200 00200010 000a08c0 08200000 50039000 04808012 00000000 01280001 00082008 10200000 22008000 00800000 00020201 00020000 18040600 07000080 08500018 00000001 c0000000 00000000 10800000 00000300 00060003 00000000 00002640 |