On Target ADRB2_HUMAN 0.48101267/CHEMBL1835860
For the given ligand Ramipril, we have found in our database that, being scored 0.48101267, the most similar ligand is CHEMBL1835860. Check out the elaboration below.
| Ramipril (Given Ligand) | CHEMBL1835860 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3[C@H](C(=O)O)C[C@@H]2CCC[C@@H]23 | CC(=O)O.OCc1cc(ccc1O)[C@@H](O)CNCCCCCCOCCCCc2cccc(NC(=O)NCC(=O)NC3CCCC3)c2 |
|
|
|
|
|
|
| 00010000 01005200 00100102 84010700 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01a02003 80181008 000c1008 10820000 02000000 00402000 00000201 00000120 38040e10 13000001 02500018 00000400 80000000 00000000 10000001 08000200 0106000b 20024000 00402600 | 00010046 01003008 20100102 04010f00 04081081 00004000 02000004 20002809 00400980 000a08d0 a8380004 4001a000 0400a002 08b02800 00080040 00083008 10840010 02400000 08402000 40020201 44000120 38250e30 23022001 83500018 00140400 80000000 00520000 10000080 0c408200 01060003 60004000 00006600 |