On Target ADRB2_HUMAN 0.47572815/CHEMBL1332942
For the given ligand Lisinopril, we have found in our database that, being scored 0.47572815, the most similar ligand is CHEMBL1332942. Check out the elaboration below.
| Lisinopril (Given Ligand) | CHEMBL1332942 (Similar Ligand) |
|---|---|
| NCCCC[C@H](N[C@@H](CCc1ccccc1)C(=O)O)C(=O)N2CCC[C@H]2C(=O)O | Oc1ccc(CC2(CCCCC2)NC(=O)Cc3ccccc3)cc1 |
|
|
|
|
|
|
| 00010000 01005200 00100102 04010600 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01202003 80180000 000c0008 10000000 02000000 00402000 00000201 00000100 38040e30 03000001 02500018 00000000 80000000 00000000 10000000 08000000 0006000b 20004000 00402600 | 00000000 01001008 20100102 00010600 00000000 00000000 02000000 20000004 00000880 000808c0 08300000 40019000 01008002 00200000 40000000 00000008 00000000 02000000 02002000 00020201 00000100 18240610 00000000 81500018 00000000 80000000 00120000 10000000 04000002 00060003 00022000 00002600 |