On Target PPARG_HUMAN 0.3119266/CHEMBL2208197
For the given ligand Fosinopril, we have found in our database that, being scored 0.3119266, the most similar ligand is CHEMBL2208197. Check out the elaboration below.
| Fosinopril (Given Ligand) | CHEMBL2208197 (Similar Ligand) |
|---|---|
| CCC(=O)O[C@@H](OP(=O)(CCCCc1ccccc1)CC(=O)N3C[C@H](C2CCCCC2)C[C@H]3C(=O)O)C(C)C | NC(=N)NCCC[C@@H](NC(=O)C(=O)c1c[nH]c2cc(O)ccc12)C(=O)O |
|
|
|
|
|
|
| 00010440 03005208 0010050a 00050e20 00080081 00000010 00004900 30000000 0000c800 000808e0 09300001 4011b000 0600801a 01a200b0 82095000 20281608 100a0028 02100003 c2406010 00000201 01004120 19562e10 03c00000 80508218 00002402 80000100 22000400 38214000 008c0200 01060303 30864000 0000c621 | 00018002 01805808 20100100 41010e10 000c1080 00000000 06002000 20002004 04600280 000908c2 08202004 4003b000 17009812 01400002 c0080040 001c000c 10000000 02000004 00600400 00060201 c0000000 18278e08 23800000 9150001c 00042000 80000000 48000000 10000000 04000010 00060003 a00c6200 00202620 |