On Target PPARG_HUMAN 0.42384106/CHEMBL2208197
For the given ligand Lisinopril, we have found in our database that, being scored 0.42384106, the most similar ligand is CHEMBL2208197. Check out the elaboration below.
| Lisinopril (Given Ligand) | CHEMBL2208197 (Similar Ligand) |
|---|---|
| NCCCC[C@H](N[C@@H](CCc1ccccc1)C(=O)O)C(=O)N2CCC[C@H]2C(=O)O | NC(=N)NCCC[C@@H](NC(=O)C(=O)c1c[nH]c2cc(O)ccc12)C(=O)O |
|
|
|
|
|
|
| 00010000 01005200 00100102 04010600 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01202003 80180000 000c0008 10000000 02000000 00402000 00000201 00000100 38040e30 03000001 02500018 00000000 80000000 00000000 10000000 08000000 0006000b 20004000 00402600 | 00018002 01805808 20100100 41010e10 000c1080 00000000 06002000 20002004 04600280 000908c2 08202004 4003b000 17009812 01400002 c0080040 001c000c 10000000 02000004 00600400 00060201 c0000000 18278e08 23800000 9150001c 00042000 80000000 48000000 10000000 04000010 00060003 a00c6200 00202620 |