On Target CASP1_HUMAN 0.38743454/CHEMBL317796
For the given ligand Fosinopril, we have found in our database that, being scored 0.38743454, the most similar ligand is CHEMBL317796. Check out the elaboration below.
| Fosinopril (Given Ligand) | CHEMBL317796 (Similar Ligand) |
|---|---|
| CCC(=O)O[C@@H](OP(=O)(CCCCc1ccccc1)CC(=O)N3C[C@H](C2CCCCC2)C[C@H]3C(=O)O)C(C)C | CC(C)C[C@H](NC(=O)CC(=O)c1ccc2ccccc2c1)C(=O)N[C@H]3CC(=O)OC3O |
|
|
|
|
|
|
| 00010440 03005208 0010050a 00050e20 00080081 00000010 00004900 30000000 0000c800 000808e0 09300001 4011b000 0600801a 01a200b0 82095000 20281608 100a0028 02100003 c2406010 00000201 01004120 19562e10 03c00000 80508218 00002402 80000100 22000400 38214000 008c0200 01060303 30864000 0000c621 | 00050000 01007a00 00100300 84010e00 00200080 00000000 00000800 20000008 00000900 000808e0 08300000 4001b000 0e008002 00002000 80181008 002c0008 10260000 02000001 00c00018 00000201 00000100 38160e08 13000081 0250001c 00001c01 80000000 00800000 30000001 08000200 0006000b a0404000 00002600 |