On Target CASP1_HUMAN 0.65789473/CHEMBL90884
For the given ligand Ramipril, we have found in our database that, being scored 0.65789473, the most similar ligand is CHEMBL90884. Check out the elaboration below.
| Ramipril (Given Ligand) | CHEMBL90884 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3[C@H](C(=O)O)C[C@@H]2CCC[C@@H]23 | CC(C)[C@H](NC(=O)CCc1ccccc1)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(=O)O)C(=O)CCCc2ccccc2 |
|
|
|
|
|
|
| 00010000 01005200 00100102 84010700 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01a02003 80181008 000c1008 10820000 02000000 00402000 00000201 00000120 38040e10 13000001 02500018 00000400 80000000 00000000 10000001 08000200 0106000b 20024000 00402600 | 00050000 01003200 00100102 04010600 00080000 00000000 00000000 20000008 00000800 000808c0 08300000 4001b000 0e00800a 00a02001 80000000 000c0008 00000000 02000001 00c02018 00000201 00000100 38140e10 01000083 02500018 00001801 80000000 00000000 10000000 08000002 0006000b 20024000 00402600 |