On Target CHLE_HUMAN 0.43137255/CHEMBL4059766
For the given ligand Captopril, we have found in our database that, being scored 0.43137255, the most similar ligand is CHEMBL4059766. Check out the elaboration below.
| Captopril (Given Ligand) | CHEMBL4059766 (Similar Ligand) |
|---|---|
| C[C@H](CS)C(=O)N1CCC[C@H]1C(=O)O | CCOC(=O)[C@@H](CCC(=O)NCCC1CCN(Cc2ccccc2)CC1)NC(=O)c3ccccc3 |
|
|
|
|
|
|
| 00010000 01005000 00100000 00100400 00080080 00000010 00000000 20000000 00000000 00000080 00200000 40013000 06008012 01040000 80080000 00080008 10000000 00000000 00400000 00400201 40000000 10040e00 03000200 00100018 00000000 00000000 00000000 10000000 00000000 00040021 20004000 01012200 | 00038008 01005800 00100100 80010700 00080080 00000000 00000000 22001000 00200000 000208c0 00200000 5003b000 06008832 01000000 00001408 00081008 10820000 02000000 00400000 00000201 00000020 18068e20 13000000 0050001c 00000400 c0000000 00800000 90000001 00000300 00060001 a0044000 00802200 |