On Target CHLE_HUMAN 0.4715447/CHEMBL4079599
For the given ligand Lisinopril, we have found in our database that, being scored 0.4715447, the most similar ligand is CHEMBL4079599. Check out the elaboration below.
| Lisinopril (Given Ligand) | CHEMBL4079599 (Similar Ligand) |
|---|---|
| NCCCC[C@H](N[C@@H](CCc1ccccc1)C(=O)O)C(=O)N2CCC[C@H]2C(=O)O | CCCCCCOC(=O)[C@@H](CCC(=O)NCCC1CCN(Cc2ccccc2)CC1)NC(=O)c3ccccc3 |
|
|
|
|
|
|
| 00010000 01005200 00100102 04010600 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01202003 80180000 000c0008 10000000 02000000 00402000 00000201 00000100 38040e30 03000001 02500018 00000000 80000000 00000000 10000000 08000000 0006000b 20004000 00402600 | 00038048 01005800 00100100 80010700 00080080 00000000 00000000 22001000 00200000 000208c0 00200000 5003b000 06008832 01800000 00001408 00081008 10820000 02000000 00402000 00000201 00000020 18068e20 13000000 0050001c 10000400 c0000000 00800000 90000001 00000300 00060003 a0044000 00802200 |