On Target PDE4B_HUMAN 0.27642277/CHEMBL144499
For the given ligand Captopril, we have found in our database that, being scored 0.27642277, the most similar ligand is CHEMBL144499. Check out the elaboration below.
| Captopril (Given Ligand) | CHEMBL144499 (Similar Ligand) |
|---|---|
| C[C@H](CS)C(=O)N1CCC[C@H]1C(=O)O | COc1ccc(cc1OC2CCCC2)[C@H]3CCN4[C@@H]3CCC4=O |
|
|
|
|
|
|
| 00010000 01005000 00100000 00100400 00080080 00000010 00000000 20000000 00000000 00000080 00200000 40013000 06008012 01040000 80080000 00080008 10000000 00000000 00400000 00400201 40000000 10040e00 03000200 00100018 00000000 00000000 00000000 10000000 00000000 00040021 20004000 01012200 | 04030000 43001208 2010010a 00210700 00081000 c2000010 02040000 20000004 00000880 000808c0 08300000 40019000 0480c00a 20200080 11000001 020ca008 00800000 02000000 00482000 00020201 00000100 18240610 01000000 81500018 00000000 80000000 00120000 10000000 04000202 0106000b 00020000 00802640 |