On Target PDE4B_HUMAN 0.6214689/CHEMBL4076662
For the given ligand Moexipril, we have found in our database that, being scored 0.6214689, the most similar ligand is CHEMBL4076662. Check out the elaboration below.
| Moexipril (Given Ligand) | CHEMBL4076662 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3Cc2cc(OC)c(OC)cc2C[C@H]3C(=O)O | COc1cc2CC3COC(=O)N3Cc2cc1OC4CCCC4 |
|
|
|
|
|
|
| 00018008 47805208 2010010a 94010700 000810a0 c0000000 03041000 22001004 00000880 000908c0 08302000 4000b000 0600c882 20202003 81181489 000c9008 10820200 02000020 00480008 00020201 80020120 38208e00 13004041 83448018 00000c00 c0000001 00324000 90000001 0c000300 0086000b 20044000 00402600 | 04000008 47c05808 20100308 90210700 000810a0 c2008000 02041000 82001004 00400a80 00080840 08300000 40008000 0080c882 20200180 11001481 0a1aa008 10860200 02080020 00480800 00020201 80020100 18208c10 13004040 8144801c 00000000 c0001003 10324000 80200001 04000300 0186000b a0040000 00000640 |