On Target ACM4_HUMAN 0.35714287/CHEMBL24369
For the given ligand Fosinopril, we have found in our database that, being scored 0.35714287, the most similar ligand is CHEMBL24369. Check out the elaboration below.
| Fosinopril (Given Ligand) | CHEMBL24369 (Similar Ligand) |
|---|---|
| CCC(=O)O[C@@H](OP(=O)(CCCCc1ccccc1)CC(=O)N3C[C@H](C2CCCCC2)C[C@H]3C(=O)O)C(C)C | CCN(CC)CCCCCOC(=O)C(C)(C1CCCCC1)c2ccccc2 |
|
|
|
|
|
|
| 00010440 03005208 0010050a 00050e20 00080081 00000010 00004900 30000000 0000c800 000808e0 09300001 4011b000 0600801a 01a200b0 82095000 20281608 100a0028 02100003 c2406010 00000201 01004120 19562e10 03c00000 80508218 00002402 80000100 22000400 38214000 008c0200 01060303 30864000 0000c621 | 00010040 01000000 00100102 00010700 00080040 00000000 00000000 20000040 00000800 000808c0 08300000 40019000 0500800a 01a00000 40040000 00081008 08820000 02000000 06402000 00000201 00010120 18000a00 01000000 00500010 00000400 80000000 00000000 10000000 00000202 00060002 00022000 00000600 |