On Target ACM4_HUMAN 0.44444445/CHEMBL479224
For the given ligand Captopril, we have found in our database that, being scored 0.44444445, the most similar ligand is CHEMBL479224. Check out the elaboration below.
| Captopril (Given Ligand) | CHEMBL479224 (Similar Ligand) |
|---|---|
| C[C@H](CS)C(=O)N1CCC[C@H]1C(=O)O | CC(=O)NC(CCCNC(=N)N)C(=O)CCCCCCCCNC(=N)N |
|
|
|
|
|
|
| 00010000 01005000 00100000 00100400 00080080 00000010 00000000 20000000 00000000 00000080 00200000 40013000 06008012 01040000 80080000 00080008 10000000 00000000 00400000 00400201 40000000 10040e00 03000200 00100018 00000000 00000000 00000000 10000000 00000000 00040021 20004000 01012200 | 00010000 01001000 00100000 00000c00 00000000 00000000 00000000 20002000 00200200 00000082 00200000 40033000 0600901a 00000000 00000000 00100000 00000000 00000000 00002000 00000201 00000000 10050610 00000000 00100018 00000000 00000000 40000000 10000000 00000010 00040001 a00a4000 00000200 |