On Target ACM4_HUMAN 0.63247865/CHEMBL211976
For the given ligand Ramipril, we have found in our database that, being scored 0.63247865, the most similar ligand is CHEMBL211976. Check out the elaboration below.
| Ramipril (Given Ligand) | CHEMBL211976 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3[C@H](C(=O)O)C[C@@H]2CCC[C@@H]23 | O[C@@H]1C[C@H](N(C1)C(=O)CC(c2ccccc2)(c3ccccc3)c4ccccc4)C(=O)N5CCC[C@@H]5C(=O)NCCC6CCNCC6 |
|
|
|
|
|
|
| 00010000 01005200 00100102 84010700 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01a02003 80181008 000c1008 10820000 02000000 00402000 00000201 00000120 38040e10 13000001 02500018 00000400 80000000 00000000 10000001 08000200 0106000b 20024000 00402600 | 00050000 01007200 00100100 04010600 00100080 00000010 00000000 21000008 00000800 000808c0 08300000 5001b000 06008012 00002003 80180000 000c0008 10000000 02000000 00c00008 00000201 00000100 38140620 03000083 02500018 00000801 a0000000 00000000 50000000 08000080 0006000b 20004000 00002e00 |