On Target TNFA_HUMAN 0.50285715/CHEMBL114343
For the given ligand Moexipril, we have found in our database that, being scored 0.50285715, the most similar ligand is CHEMBL114343. Check out the elaboration below.
| Moexipril (Given Ligand) | CHEMBL114343 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3Cc2cc(OC)c(OC)cc2C[C@H]3C(=O)O | COC(=O)CC(N1C(=O)c2ccc(N)cc2C1=O)c3ccc(OC)c(OC)c3 |
|
|
|
|
|
|
| 00018008 47805208 2010010a 94010700 000810a0 c0000000 03041000 22001004 00000880 000908c0 08302000 4000b000 0600c882 20202003 81181489 000c9008 10820200 02000020 00480008 00020201 80020120 38208e00 13004041 83448018 00000c00 c0000001 00324000 90000001 0c000300 0086000b 20044000 00402600 | 10000002 46801808 20100108 90010700 00001000 40008000 02040080 02001000 00800800 00080840 08300004 40009000 0c00c802 20200000 01000441 10088008 00222000 02000001 00d80018 00020201 c0020100 18128e80 210000c0 0044801c 00041801 c0200000 00324000 80000000 00400300 0006000b a0040000 00000600 |