On Target DRD2_HUMAN 0.36410257/CHEMBL3676863
For the given ligand Fosinopril, we have found in our database that, being scored 0.36410257, the most similar ligand is CHEMBL3676863. Check out the elaboration below.
| Fosinopril (Given Ligand) | CHEMBL3676863 (Similar Ligand) |
|---|---|
| CCC(=O)O[C@@H](OP(=O)(CCCCc1ccccc1)CC(=O)N3C[C@H](C2CCCCC2)C[C@H]3C(=O)O)C(C)C | O=C(N[C@@H]1CC[C@@H](CCN2CCC(CC2)c3coc4ccccc34)CC1)C5CCCO5 |
|
|
|
|
|
|
| 00010440 03005208 0010050a 00050e20 00080081 00000010 00004900 30000000 0000c800 000808e0 09300001 4011b000 0600801a 01a200b0 82095000 20281608 100a0028 02100003 c2406010 00000201 01004120 19562e10 03c00000 80508218 00002402 80000100 22000400 38214000 008c0200 01060303 30864000 0000c621 | 00010000 01201200 00180100 80014600 00080281 00000100 00004000 60200200 00024800 000808c0 0c300000 5001d000 44008422 01000080 00081008 180c0008 10000020 82010000 02402000 00000201 00000120 18040618 13000000 0058001c 18000400 80004000 00000010 1a800011 a0002200 0106000b 00020000 00002600 |