On Target DRD2_HUMAN 0.5555556/CHEMBL2335740
For the given ligand Moexipril, we have found in our database that, being scored 0.5555556, the most similar ligand is CHEMBL2335740. Check out the elaboration below.
| Moexipril (Given Ligand) | CHEMBL2335740 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3Cc2cc(OC)c(OC)cc2C[C@H]3C(=O)O | COc1cc2CCN3CC[C@@](O)(C[C@@H]3c2cc1O)c4ccc(Cl)cc4 |
|
|
|
|
|
|
| 00018008 47805208 2010010a 94010700 000810a0 c0000000 03041000 22001004 00000880 000908c0 08302000 4000b000 0600c882 20202003 81181489 000c9008 10820200 02000020 00480008 00020201 80020120 38208e00 13004041 83448018 00000c00 c0000001 00324000 90000001 0c000300 0086000b 20044000 00402600 | 00008008 47000208 2010010a 10010600 00001020 c0004002 02041000 22001001 00000980 000808c0 08300000 50818800 020048a6 20200000 01000421 000e8008 00000200 02000020 00c82000 00020201 00020100 18208130 010040c0 81540010 00002001 c0000001 00364000 90000000 04000302 0006000a 60040000 00022600 |